EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=CC(=C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12+ |
| InChIKey | JSNRRGGBADWTMC-NTCAYCPXSA-N |
| Roles Classification |
|---|
| Biological Roles: | alarm pheromone A pheromone which is released by an organism when damaged by a predator which warns other individuals that there is a danger. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-β-farnesene (CHEBI:10418) has role alarm pheromone (CHEBI:72575) |
| trans-β-farnesene (CHEBI:10418) has role metabolite (CHEBI:25212) |
| trans-β-farnesene (CHEBI:10418) is a β-farnesene (CHEBI:39241) |
| Incoming Relation(s) |
| β-geranylfarnesene (CHEBI:138226) has functional parent trans-β-farnesene (CHEBI:10418) |
| β-heptaprene (CHEBI:138228) has functional parent trans-β-farnesene (CHEBI:10418) |
| β-hexaprene (CHEBI:138227) has functional parent trans-β-farnesene (CHEBI:10418) |
| IUPAC Name |
|---|
| (6E)-7,11-dimethyl-3-methylenedodeca-1,6,10-triene |
| Synonyms | Source |
|---|---|
| (6E)-7,11-dimethyl-3-methylene-1,6,10-dodecatriene | NIST Chemistry WebBook |
| beta-Farnesene | KEGG COMPOUND |
| (E)-7,11-dimethyl-3-methylenedodeca-1,6,10-triene | ChemIDplus |
| (E)-β-farnesene | NIST Chemistry WebBook |
| trans-7,11-dimethyl-3-methylene-1,6,10-dodecatriene | ChEBI |
| trans-β-farnesene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (E)-β-farnesene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1386 | BPDB |
| C00003131 | KNApSAcK |
| C09666 | KEGG COMPOUND |
| CPD-8239 | MetaCyc |
| HMDB0035913 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721510 | Reaxys |
| CAS:18794-84-8 | KEGG COMPOUND |
| CAS:18794-84-8 | NIST Chemistry WebBook |
| CAS:18794-84-8 | ChemIDplus |
| Citations |
|---|