EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=CC(=C)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12- |
| InChIKey | JSNRRGGBADWTMC-QINSGFPZSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-β-farnesene (CHEBI:39242) is a β-farnesene (CHEBI:39241) |
| IUPAC Name |
|---|
| (6Z)-7,11-dimethyl-3-methylenedodeca-1,6,10-triene |
| Synonyms | Source |
|---|---|
| (6Z)-7,11-dimethyl-3-methylene-1,6,10-dodecatriene | NIST Chemistry WebBook |
| cis-β-farnesene | NIST Chemistry WebBook |
| (Z)-β-farnesene | NIST Chemistry WebBook |
| β-cis-farnesene | NIST Chemistry WebBook |
| β-(Z)-farnesene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (Z)-β-farnesene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1840985 | Beilstein |
| CAS:28973-97-9 | NIST Chemistry WebBook |