EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5AuO4S |
| Net Charge | 0 |
| Average Mass | 346.114 |
| Monoisotopic Mass | 345.95742 |
| SMILES | O=C(O)CC([S][Au])C(=O)O |
| InChI | InChI=1S/C4H6O4S.Au/c5-3(6)1-2(9)4(7)8;/h2,9H,1H2,(H,5,6)(H,7,8);/q;+1/p-1 |
| InChIKey | XJHSMFDIQHVMCY-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aurothiomalic acid (CHEBI:38722) has functional parent thiomalic acid (CHEBI:38705) |
| aurothiomalic acid (CHEBI:38722) is a gold coordination entity (CHEBI:33971) |
| aurothiomalic acid (CHEBI:38722) is a sulfur-containing carboxylic acid (CHEBI:33576) |
| aurothiomalic acid (CHEBI:38722) is conjugate acid of aurothiomalate(2−) (CHEBI:68613) |
| Incoming Relation(s) |
| (S)-aurothiomalic acid (CHEBI:38727) is a aurothiomalic acid (CHEBI:38722) |
| aurothiomalate(2−) (CHEBI:68613) is conjugate base of aurothiomalic acid (CHEBI:38722) |
| IUPAC Names |
|---|
| gold(1+) 1,2-dicarboxyethanethiolate |
| 1,2-dicarboxyethanethiolatogold(I) |
| 1,2-dicarboxyethylsulfanylgold |
| Synonyms | Source |
|---|---|
| aurothiomalate | ChemIDplus |
| mercaptobutanedioic acid, monogold(1+) salt | ChemIDplus |
| (1,2-dicarboxyethylthio)gold | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4030297 | Beilstein |
| Gmelin:1288314 | Gmelin |
| Gmelin:1043252 | Gmelin |
| CAS:4846-27-9 | ChemIDplus |