EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38705 - thiomalic acid
| Formula | C4H6O4S |
| Net Charge | 0 |
| Average Mass | 150.155 |
| Monoisotopic Mass | 149.99868 |
| SMILES | O=C(O)CC(S)C(=O)O |
| InChI | InChI=1S/C4H6O4S/c5-3(6)1-2(9)4(7)8/h2,9H,1H2,(H,5,6)(H,7,8) |
| InChIKey | NJRXVEJTAYWCQJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiomalic acid (CHEBI:38705) has functional parent succinic acid (CHEBI:15741) |
| thiomalic acid (CHEBI:38705) is a C4-dicarboxylic acid (CHEBI:66873) |
| thiomalic acid (CHEBI:38705) is conjugate acid of thiomalate(1−) (CHEBI:38708) |
| Incoming Relation(s) |
| aurothiomalic acid (CHEBI:38722) has functional parent thiomalic acid (CHEBI:38705) |
| diethyl 2-sulfanylbutanedioate (CHEBI:195233) has functional parent thiomalic acid (CHEBI:38705) |
| (R)-thiomalic acid (CHEBI:38719) is a thiomalic acid (CHEBI:38705) |
| (S)-thiomalic acid (CHEBI:38720) is a thiomalic acid (CHEBI:38705) |
| thiomalate(1−) (CHEBI:38708) is conjugate base of thiomalic acid (CHEBI:38705) |
| IUPAC Name |
|---|
| 2-sulfanylbutanedioic acid |
| Synonyms | Source |
|---|---|
| 2-sulfanylsuccinic acid | NIST Chemistry WebBook |
| α-mercaptosuccinic acid | NIST Chemistry WebBook |
| 2-mercaptosuccinic acid | NIST Chemistry WebBook |
| mercaptosuccinic acid | ChemIDplus |
| monomercaptosuccinic acid | ChemIDplus |
| 2-thiomalic acid | ChemIDplus |