EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3AuO4S |
| Net Charge | -2 |
| Average Mass | 344.098 |
| Monoisotopic Mass | 343.94287 |
| SMILES | O=C([O-])CC([S][Au])C(=O)[O-] |
| InChI | InChI=1S/C4H6O4S.Au/c5-3(6)1-2(9)4(7)8;/h2,9H,1H2,(H,5,6)(H,7,8);/q;+1/p-3 |
| InChIKey | XJHSMFDIQHVMCY-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aurothiomalate(2−) (CHEBI:68613) is a C4-dicarboxylate (CHEBI:61336) |
| aurothiomalate(2−) (CHEBI:68613) is conjugate base of aurothiomalic acid (CHEBI:38722) |
| Incoming Relation(s) |
| disodium aurothiomalate (CHEBI:35864) has part aurothiomalate(2−) (CHEBI:68613) |
| aurothiomalic acid (CHEBI:38722) is conjugate acid of aurothiomalate(2−) (CHEBI:68613) |
| Synonym | Source |
|---|---|
| aurothiomalate dianion | ChEBI |