EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O4S |
| Net Charge | 0 |
| Average Mass | 150.155 |
| Monoisotopic Mass | 149.99868 |
| SMILES | O=C(O)C[C@@H](S)C(=O)O |
| InChI | InChI=1S/C4H6O4S/c5-3(6)1-2(9)4(7)8/h2,9H,1H2,(H,5,6)(H,7,8)/t2-/m1/s1 |
| InChIKey | NJRXVEJTAYWCQJ-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-thiomalic acid (CHEBI:38719) is a thiomalic acid (CHEBI:38705) |
| (R)-thiomalic acid (CHEBI:38719) is enantiomer of (S)-thiomalic acid (CHEBI:38720) |
| Incoming Relation(s) |
| (S)-thiomalic acid (CHEBI:38720) is enantiomer of (R)-thiomalic acid (CHEBI:38719) |
| IUPAC Name |
|---|
| (2R)-2-sulfanylbutanedioic acid |
| Synonym | Source |
|---|---|
| (2R)-2-mercaptosuccinic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1723545 | Beilstein |
| Gmelin:1828749 | Gmelin |