EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13FO2 |
| Net Charge | 0 |
| Average Mass | 244.265 |
| Monoisotopic Mass | 244.08996 |
| SMILES | C[C@@H](C(=O)O)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | SYTBZMRGLBWNTM-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-flurbiprofen (CHEBI:38666) is a flurbiprofen (CHEBI:5130) |
| (R)-flurbiprofen (CHEBI:38666) is enantiomer of (S)-flurbiprofen (CHEBI:42446) |
| Incoming Relation(s) |
| (S)-flurbiprofen (CHEBI:42446) is enantiomer of (R)-flurbiprofen (CHEBI:38666) |
| IUPAC Name |
|---|
| (2R)-2-(2-fluoro-[1,1'-biphenyl-4-yl])propanoic acid |
| Synonyms | Source |
|---|---|
| Tarenflurbil | ChemIDplus |
| (−)-(2R)-2-(2-fluorobiphenyl-4-yl)propanoic acid | ChemIDplus |
| Flurizan | ChemIDplus |
| (R)-2-fluoro-α-methyl(1,1'-biphenyl)-4-acetic acid | ChemIDplus |
| (2R)-2-(2-fluorobiphenyl-4-yl)propanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4686157 | Beilstein |
| Beilstein:5745751 | Beilstein |
| CAS:51543-40-9 | ChemIDplus |