EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O3 |
| Net Charge | -1 |
| Average Mass | 127.119 |
| Monoisotopic Mass | 127.04007 |
| SMILES | C/C=C/CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2-3H,4H2,1H3,(H,8,9)/p-1/b3-2+ |
| InChIKey | XGNKMQBCAVIQOR-NSCUHMNNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-oxohex-4-enoate (CHEBI:19751) is a 2-oxohex-4-enoate (CHEBI:38351) |
| trans-2-oxohex-4-enoate (CHEBI:19751) is conjugate base of trans-2-oxohex-4-enoic acid (CHEBI:28998) |
| Incoming Relation(s) |
| trans-2-oxohex-4-enoic acid (CHEBI:28998) is conjugate acid of trans-2-oxohex-4-enoate (CHEBI:19751) |
| IUPAC Name |
|---|
| (4E)-2-oxohex-4-enoate |
| Synonyms | Source |
|---|---|
| 2-oxohex-trans-4-enoate | UM-BBD |
| (E)-2-oxo-4-hexenoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| c0205 | UM-BBD |