EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10F3NO5 |
| Net Charge | 0 |
| Average Mass | 329.230 |
| Monoisotopic Mass | 329.05111 |
| SMILES | O=C1CCCC(=O)C1C(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10F3NO5/c15-14(16,17)7-4-5-8(9(6-7)18(22)23)13(21)12-10(19)2-1-3-11(12)20/h4-6,12H,1-3H2 |
| InChIKey | OUBCNLGXQFSTLU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitisinone (CHEBI:50378) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| nitisinone (CHEBI:50378) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| nitisinone (CHEBI:50378) is a C-nitro compound (CHEBI:35716) |
| nitisinone (CHEBI:50378) is a cyclohexanones (CHEBI:23482) |
| nitisinone (CHEBI:50378) is a mesotrione (CHEBI:38321) |
| IUPAC Name |
|---|
| 2-[2-nitro-4-(trifluoromethyl)benzoyl]cyclohexane-1,3-dione |
| INNs | Source |
|---|---|
| nitisinone | ChemIDplus |
| nitisinona | WHO MedNet |
| nitisinonum | WHO MedNet |
| Synonym | Source |
|---|---|
| 2-(alpha,alpha,alpha-Trifluoro-2-nitro-p-tuluoyl)-1,3-cyclohexanedione | ChemIDplus |
| Brand Name | Source |
|---|---|
| Orfadin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D05177 | KEGG DRUG |
| DB00348 | DrugBank |
| EP186118 | Patent |
| US5006158 | Patent |
| Nitisinone | Wikipedia |
| US4774360 | Patent |
| US5550165 | Patent |
| US5668089 | Patent |
| HMDB0014492 | HMDB |
| 1944 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8639943 | Reaxys |
| CAS:104206-65-7 | ChemIDplus |
| Citations |
|---|