EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClNO2S |
| Net Charge | 0 |
| Average Mass | 321.829 |
| Monoisotopic Mass | 321.05903 |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1 |
| InChI | InChI=1S/C16H16ClNO2S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14/h2-5,7,9,15H,6,8,10H2,1H3/t15-/m0/s1 |
| InChIKey | GKTWGGQPFAXNFI-HNNXBMFYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | P2Y12 receptor antagonist An antagonist at the P2Y12 receptor |
| Applications: | anticoagulant An agent that prevents blood clotting. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clopidogrel (CHEBI:37941) has functional parent ticlopidine (CHEBI:9588) |
| clopidogrel (CHEBI:37941) has role anticoagulant (CHEBI:50249) |
| clopidogrel (CHEBI:37941) has role P2Y12 receptor antagonist (CHEBI:68563) |
| clopidogrel (CHEBI:37941) has role platelet aggregation inhibitor (CHEBI:50427) |
| clopidogrel (CHEBI:37941) is a methyl ester (CHEBI:25248) |
| clopidogrel (CHEBI:37941) is a monochlorobenzenes (CHEBI:83403) |
| clopidogrel (CHEBI:37941) is a thienopyridine (CHEBI:37942) |
| Incoming Relation(s) |
| clopidogrel sulfate (CHEBI:3759) has part clopidogrel (CHEBI:37941) |
| IUPAC Name |
|---|
| methyl (2S)-(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate |
| INNs | Source |
|---|---|
| clopidogrel | WHO MedNet |
| clopidogrel | WHO MedNet |
| clopidogrel | WHO MedNet |
| clopidogrelum | ChemIDplus |
| Synonym | Source |
|---|---|
| (+)-Clopidogrel | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8151914 | Beilstein |
| CAS:113665-84-2 | ChemIDplus |
| Citations |
|---|