EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C16H16ClNO2S.HO4S |
| Net Charge | 0 |
| Average Mass | 419.908 |
| Monoisotopic Mass | 419.02641 |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1.O=S(=O)([O-])O.[H+] |
| InChI | InChI=1S/C16H16ClNO2S.H2O4S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-5(2,3)4/h2-5,7,9,15H,6,8,10H2,1H3;(H2,1,2,3,4)/t15-;/m0./s1 |
| InChIKey | FDEODCTUSIWGLK-RSAXXLAASA-N |
| Roles Classification |
|---|
| Biological Role: | P2Y12 receptor antagonist An antagonist at the P2Y12 receptor |
| Applications: | anticoagulant An agent that prevents blood clotting. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clopidogrel sulfate (CHEBI:3759) has part clopidogrel (CHEBI:37941) |
| clopidogrel sulfate (CHEBI:3759) has role anticoagulant (CHEBI:50249) |
| clopidogrel sulfate (CHEBI:3759) has role P2Y12 receptor antagonist (CHEBI:68563) |
| clopidogrel sulfate (CHEBI:3759) has role platelet aggregation inhibitor (CHEBI:50427) |
| clopidogrel sulfate (CHEBI:3759) is a azaheterocycle sulfate salt (CHEBI:38017) |
| clopidogrel sulfate (CHEBI:3759) is a organoammonium sulfate salt (CHEBI:37852) |
| IUPAC Name |
|---|
| 5-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium hydrogen sulfate |
| Synonyms | Source |
|---|---|
| Clopidogrel bisulfate | ChemIDplus |
| Clopidogrel hemisulfate | ChemIDplus |
| Clopidogrel hydrogen sulfate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Plavix | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9967887 | Beilstein |
| CAS:120202-66-6 | ChemIDplus |