EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14ClNS |
| Net Charge | 0 |
| Average Mass | 263.793 |
| Monoisotopic Mass | 263.05355 |
| SMILES | Clc1ccccc1CN1CCc2sccc2C1 |
| InChI | InChI=1S/C14H14ClNS/c15-13-4-2-1-3-11(13)9-16-7-5-14-12(10-16)6-8-17-14/h1-4,6,8H,5,7,9-10H2 |
| InChIKey | PHWBOXQYWZNQIN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | P2Y12 receptor antagonist An antagonist at the P2Y12 receptor |
| Applications: | hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. fibrin modulating drug A drug that affects the function of fibrin in blood coagulation. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ticlopidine (CHEBI:9588) has role anticoagulant (CHEBI:50249) |
| ticlopidine (CHEBI:9588) has role fibrin modulating drug (CHEBI:48676) |
| ticlopidine (CHEBI:9588) has role hematologic agent (CHEBI:50248) |
| ticlopidine (CHEBI:9588) has role P2Y12 receptor antagonist (CHEBI:68563) |
| ticlopidine (CHEBI:9588) has role platelet aggregation inhibitor (CHEBI:50427) |
| ticlopidine (CHEBI:9588) is a monochlorobenzenes (CHEBI:83403) |
| ticlopidine (CHEBI:9588) is a thienopyridine (CHEBI:37942) |
| Incoming Relation(s) |
| 7-hydroxyticlopidine (CHEBI:145218) has functional parent ticlopidine (CHEBI:9588) |
| clopidogrel (CHEBI:37941) has functional parent ticlopidine (CHEBI:9588) |
| ticlopidine hydrochloride (CHEBI:9589) has part ticlopidine (CHEBI:9588) |
| IUPAC Name |
|---|
| 5-(2-chlorobenzyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| INNs | Source |
|---|---|
| ticlopidina | ChemIDplus |
| ticlopidine | ChemIDplus |
| ticlopidine | WHO MedNet |
| ticlopidinum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1216802 | Reaxys |
| CAS:55142-85-3 | ChemIDplus |
| Citations |
|---|