EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:37888 - (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid
| Formula | C7H8O4 |
| Net Charge | 0 |
| Average Mass | 156.137 |
| Monoisotopic Mass | 156.04226 |
| SMILES | O=C(O)[C@@]1(O)C=CC=C[C@@H]1O |
| InChI | InChI=1S/C7H8O4/c8-5-3-1-2-4-7(5,11)6(9)10/h1-5,8,11H,(H,9,10)/t5-,7+/m0/s1 |
| InChIKey | PUCYIVFXTPWJDD-CAHLUQPWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) is a cis-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:18340) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) is conjugate acid of (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60129) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) is enantiomer of (1S,6R)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37889) |
| Incoming Relation(s) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60129) is conjugate base of (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) |
| (1S,6R)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37889) is enantiomer of (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) |
| IUPAC Name |
|---|
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| (1R,2S)-1,2-dihydroxycyclohexa-3,5-diene-1-carboxylic acid | ChEBI |
| cis-1,2-Dihydroxycyclohexa-3,5-diene-1-carboxylate | KEGG COMPOUND |
| cis-1,6-Dihydroxy-2,4-cyclohexadiene-1-carboxylic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06321 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10335631 | Beilstein |