EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:37889 - (1S,6R)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid
| Formula | C7H8O4 |
| Net Charge | 0 |
| Average Mass | 156.137 |
| Monoisotopic Mass | 156.04226 |
| SMILES | O=C(O)[C@]1(O)C=CC=C[C@H]1O |
| InChI | InChI=1S/C7H8O4/c8-5-3-1-2-4-7(5,11)6(9)10/h1-5,8,11H,(H,9,10)/t5-,7+/m1/s1 |
| InChIKey | PUCYIVFXTPWJDD-VDTYLAMSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,6R)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37889) is a cis-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:18340) |
| (1S,6R)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37889) is conjugate acid of (1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60131) |
| (1S,6R)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37889) is enantiomer of (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) |
| Incoming Relation(s) |
| (1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60131) is conjugate base of (1S,6R)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37889) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) is enantiomer of (1S,6R)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37889) |
| IUPAC Name |
|---|
| (1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| (1S,2R)-1,2-dihydroxycyclohexa-3,5-diene-1-carboxylic acid | ChEBI |
| cis-(-)-1,6-dihydroxy-2,4-cyclohexadiene-1-carboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7369721 | Beilstein |
| CAS:32359-20-9 | ChemIDplus |