EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7O4 |
| Net Charge | -1 |
| Average Mass | 155.129 |
| Monoisotopic Mass | 155.03498 |
| SMILES | O=C([O-])[C@@]1(O)C=CC=C[C@@H]1O |
| InChI | InChI=1S/C7H8O4/c8-5-3-1-2-4-7(5,11)6(9)10/h1-5,8,11H,(H,9,10)/p-1/t5-,7+/m0/s1 |
| InChIKey | PUCYIVFXTPWJDD-CAHLUQPWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60129) is a cis-1,6-dihydroxycyclohexa-2,4-dienecarboxylate (CHEBI:36465) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60129) is conjugate base of (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60129) is enantiomer of (1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60131) |
| Incoming Relation(s) |
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-dienecarboxylic acid (CHEBI:37888) is conjugate acid of (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60129) |
| (1S,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60131) is enantiomer of (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate (CHEBI:60129) |
| IUPAC Name |
|---|
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate |
| Synonym | Source |
|---|---|
| (1R,2S)-1,2-dihydroxycyclohexa-3,5-diene-1-carboxylate | ChEBI |
| UniProt Name | Source |
|---|---|
| (1R,6S)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylate | UniProt |