EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO2S |
| Net Charge | 0 |
| Average Mass | 175.253 |
| Monoisotopic Mass | 175.06670 |
| SMILES | CC1N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C7H13NO2S/c1-4-8-5(6(9)10)7(2,3)11-4/h4-5,8H,1-3H3,(H,9,10)/t4?,5-/m0/s1 |
| InChIKey | MQQSPQRNCBFBSG-AKGZTFGVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2,5,5-trimethylthiazolidine-4-carboxylic acid (CHEBI:141059) has functional parent penicillanic acid (CHEBI:37806) |
| (S)-2,5,5-trimethylthiazolidine-4-carboxylic acid (CHEBI:141059) is a monocarboxylic acid (CHEBI:25384) |
| (S)-2,5,5-trimethylthiazolidine-4-carboxylic acid (CHEBI:141059) is a thiazolidines (CHEBI:35622) |
| IUPAC Name |
|---|
| (4S)-2,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonym | Source |
|---|---|
| (S)-2,5,5-Trimethyl-thiazolidine-4-carboxylic acid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4462 | Reaxys |
| Citations |
|---|