EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O5 |
| Net Charge | -1 |
| Average Mass | 135.095 |
| Monoisotopic Mass | 135.02990 |
| SMILES | O=C([O-])[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/p-1/t2-,3-/m1/s1 |
| InChIKey | JPIJQSOTBSSVTP-PWNYCUMCSA-M |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythronate (CHEBI:136591) is a erythronate (CHEBI:133792) |
| D-erythronate (CHEBI:136591) is conjugate base of D-erythronic acid (CHEBI:37655) |
| Incoming Relation(s) |
| D-erythronic acid (CHEBI:37655) is conjugate acid of D-erythronate (CHEBI:136591) |
| IUPAC Name |
|---|
| (2R,3R)-2,3,4-trihydroxybutanoate |
| UniProt Name | Source |
|---|---|
| D-erythronate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19877 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4664614 | Reaxys |