EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)cc(O[C@H]3O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]3O)c12 |
| InChI | InChI=1S/C21H20O11/c22-7-13-15(25)17(27)19(29)21(32-13)31-12-6-10(24)5-11-14(12)16(26)18(28)20(30-11)8-1-3-9(23)4-2-8/h1-6,13,15,17,19,21-25,27-29H,7H2/t13-,15-,17+,19-,21-/m0/s1 |
| InChIKey | ZSDLSQASILNAAH-YGXKTJSJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 5-O-β-L-glucopyranoside (CHEBI:75805) has functional parent β-L-glucose (CHEBI:37631) |
| kaempferol 5-O-β-L-glucopyranoside (CHEBI:75805) has role metabolite (CHEBI:25212) |
| kaempferol 5-O-β-L-glucopyranoside (CHEBI:75805) is a flavonols (CHEBI:28802) |
| kaempferol 5-O-β-L-glucopyranoside (CHEBI:75805) is a kaempferol O-glucoside (CHEBI:64634) |
| kaempferol 5-O-β-L-glucopyranoside (CHEBI:75805) is a monosaccharide derivative (CHEBI:63367) |
| kaempferol 5-O-β-L-glucopyranoside (CHEBI:75805) is a trihydroxyflavone (CHEBI:27116) |
| kaempferol 5-O-β-L-glucopyranoside (CHEBI:75805) is a β-L-glucoside (CHEBI:75759) |
| IUPAC Name |
|---|
| 3,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-5-yl β-L-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1336740 | Reaxys |