EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O4 |
| Net Charge | 0 |
| Average Mass | 122.120 |
| Monoisotopic Mass | 122.05791 |
| SMILES | OC[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4+ |
| InChIKey | UNXHWFMMPAWVPI-ZXZARUISSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (10952545) | |
| Carum carvi (ncbitaxon:48032) | - | DOI (10.1016/S0031-9422(02)00288-1) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythritol (CHEBI:17113) has role antioxidant (CHEBI:22586) |
| erythritol (CHEBI:17113) has role human metabolite (CHEBI:77746) |
| erythritol (CHEBI:17113) has role plant metabolite (CHEBI:76924) |
| erythritol (CHEBI:17113) is a butane-1,2,3,4-tetrol (CHEBI:48299) |
| Incoming Relation(s) |
| D-erythritol 1-phosphate (CHEBI:63319) has functional parent erythritol (CHEBI:17113) |
| D-erythritol 4-phosphate (CHEBI:15770) has functional parent erythritol (CHEBI:17113) |
| 2-methylerythritol (CHEBI:86367) has functional parent erythritol (CHEBI:17113) |
| erythrityl tetranitrate (CHEBI:60072) has functional parent erythritol (CHEBI:17113) |
| IUPAC Name |
|---|
| meso-erythritol |
| Synonyms | Source |
|---|---|
| (2R,3S)-butane-1,2,3,4-tetrol | IUPAC |
| Erythrit | NIST Chemistry WebBook |
| Erythrite | KEGG COMPOUND |
| Erythritol | KEGG COMPOUND |
| Erythrol | KEGG COMPOUND |
| erythro-tetritol | IUPAC |
| UniProt Name | Source |
|---|---|
| erythritol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00001161 | KNApSAcK |
| C00503 | KEGG COMPOUND |
| DB04481 | DrugBank |
| Erythritol | Wikipedia |
| ERYTHRITOL | MetaCyc |
| HMDB0002994 | HMDB |
| MRY | PDBeChem |
| Citations |
|---|