EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N4O12 |
| Net Charge | 0 |
| Average Mass | 302.108 |
| Monoisotopic Mass | 301.99822 |
| SMILES | O=[N+]([O-])OC[C@H](O[N+](=O)[O-])[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C4H6N4O12/c9-5(10)17-1-3(19-7(13)14)4(20-8(15)16)2-18-6(11)12/h3-4H,1-2H2/t3-,4+ |
| InChIKey | SNFOERUNNSHUGP-ZXZARUISSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythrityl tetranitrate (CHEBI:60072) has functional parent erythritol (CHEBI:17113) |
| erythrityl tetranitrate (CHEBI:60072) has role explosive (CHEBI:63490) |
| erythrityl tetranitrate (CHEBI:60072) has role vasodilator agent (CHEBI:35620) |
| erythrityl tetranitrate (CHEBI:60072) is a nitrate ester (CHEBI:51080) |
| IUPAC Name |
|---|
| (2R*,3S*)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate |
| INNs | Source |
|---|---|
| tetranitrate d'eritrityle | ChemIDplus |
| tetranitrato de eritritilo | ChemIDplus |
| eritrityli tetranitras | ChemIDplus |
| eritrityl tetranitrate | KEGG DRUG |
| Synonyms | Source |
|---|---|
| erythrol tetranitrate | ChemIDplus |
| 1,2,3,4-butanetetralyl tetranitrate | ChemIDplus |
| (2R*,3S)-rel-1,2,3,4-butanetetroltetranitrate | ChEBI |
| tetranitrol | ChemIDplus |
| tetranitrin | ChemIDplus |
| meso-erythritol tetranitrate | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D04051 | KEGG DRUG |
| DB01613 | DrugBank |
| Erythritol_tetranitrate | Wikipedia |
| 1047 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1730082 | Beilstein |
| CAS:7297-25-8 | ChemIDplus |