EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11O7P |
| Net Charge | 0 |
| Average Mass | 202.099 |
| Monoisotopic Mass | 202.02424 |
| SMILES | O=P(O)(O)OC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H11O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h3-7H,1-2H2,(H2,8,9,10)/t3-,4+/m1/s1 |
| InChIKey | QRDCEYBRRFPBMZ-DMTCNVIQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythritol 1-phosphate (CHEBI:63319) has functional parent erythritol (CHEBI:17113) |
| D-erythritol 1-phosphate (CHEBI:63319) is a alditol 1-phosphate (CHEBI:22292) |
| D-erythritol 1-phosphate (CHEBI:63319) is conjugate acid of D-erythritol 1-phosphate(2−) (CHEBI:131849) |
| Incoming Relation(s) |
| D-erythritol 1-phosphate(2−) (CHEBI:131849) is conjugate base of D-erythritol 1-phosphate (CHEBI:63319) |
| IUPAC Names |
|---|
| (2S,3R)-2,3,4-trihydroxybutyl dihydrogen phosphate |
| D-erythritol 1-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| D-erythro-tetritol 1-phosphate | ChEBI |
| L-erythritol 4-phosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725683 | Reaxys |
| Citations |
|---|