EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11O7P |
| Net Charge | 0 |
| Average Mass | 202.099 |
| Monoisotopic Mass | 202.02424 |
| SMILES | O=P(O)(O)OC[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H11O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h3-7H,1-2H2,(H2,8,9,10)/t3-,4+/m0/s1 |
| InChIKey | QRDCEYBRRFPBMZ-IUYQGCFVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythritol 4-phosphate (CHEBI:15770) has functional parent erythritol (CHEBI:17113) |
| D-erythritol 4-phosphate (CHEBI:15770) is a alditol 4-phosphate (CHEBI:22294) |
| D-erythritol 4-phosphate (CHEBI:15770) is a tetritol phosphate (CHEBI:26980) |
| D-erythritol 4-phosphate (CHEBI:15770) is conjugate acid of D-erythritol 4-phosphate(2−) (CHEBI:57508) |
| Incoming Relation(s) |
| D-erythritol 4-phosphate(2−) (CHEBI:57508) is conjugate base of D-erythritol 4-phosphate (CHEBI:15770) |
| IUPAC Names |
|---|
| D-erythritol 4-(dihydrogen phosphate) |
| (2R,3S)-2,3,4-trihydroxybutyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| D-Erythritol 4-phosphate | KEGG COMPOUND |
| 4-O-phosphono-D-erythritol | IUPAC |
| L-Erythritol 1-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03494 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725684 | Beilstein |