EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:37011 - 4-oxoproline
| Formula | C5H7NO3 |
| Net Charge | 0 |
| Average Mass | 129.115 |
| Monoisotopic Mass | 129.04259 |
| SMILES | O=C1CNC(C(=O)O)C1 |
| InChI | InChI=1S/C5H7NO3/c7-3-1-4(5(8)9)6-2-3/h4,6H,1-2H2,(H,8,9) |
| InChIKey | HFXAFXVXPMUQCQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxoproline (CHEBI:37011) has role metabolite (CHEBI:25212) |
| 4-oxoproline (CHEBI:37011) is a oxoproline (CHEBI:25801) |
| 4-oxoproline (CHEBI:37011) is conjugate acid of 4-oxoprolinate (CHEBI:58670) |
| 4-oxoproline (CHEBI:37011) is tautomer of 4-oxoproline zwitterion (CHEBI:77656) |
| Incoming Relation(s) |
| 4-oxo-L-proline (CHEBI:16821) is a 4-oxoproline (CHEBI:37011) |
| 4-oxoprolinate (CHEBI:58670) is conjugate base of 4-oxoproline (CHEBI:37011) |
| 4-oxoproline zwitterion (CHEBI:77656) is tautomer of 4-oxoproline (CHEBI:37011) |
| IUPAC Names |
|---|
| 4-oxopyrrolidine-2-carboxylic acid |
| 4-oxoproline |
| Synonyms | Source |
|---|---|
| 4-Oxoproline | KEGG COMPOUND |
| 4-oxo-DL-proline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4-OXOPROLINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:82136 | Reaxys |
| Citations |
|---|