EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16821 - 4-oxo-L-proline
| Formula | C5H7NO3 |
| Net Charge | 0 |
| Average Mass | 129.115 |
| Monoisotopic Mass | 129.04259 |
| SMILES | [H][C@@]1(C(=O)O)CC(=O)CN1 |
| InChI | InChI=1S/C5H7NO3/c7-3-1-4(5(8)9)6-2-3/h4,6H,1-2H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | HFXAFXVXPMUQCQ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxo-L-proline (CHEBI:16821) is a L-proline derivative (CHEBI:84186) |
| 4-oxo-L-proline (CHEBI:16821) is a 4-oxoproline (CHEBI:37011) |
| 4-oxo-L-proline (CHEBI:16821) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-oxo-L-proline (CHEBI:16821) is tautomer of 4-oxo-L-proline zwitterion (CHEBI:84813) |
| Incoming Relation(s) |
| 4-oxo-L-proline zwitterion (CHEBI:84813) is tautomer of 4-oxo-L-proline (CHEBI:16821) |
| IUPAC Names |
|---|
| (2S)-4-oxopyrrolidine-2-carboxylic acid |
| 4-oxo-L-proline |
| Synonyms | Source |
|---|---|
| 4-ketoproline | ChemIDplus |
| 4-Oxo-L-proline | KEGG COMPOUND |