EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO3 |
| Net Charge | 0 |
| Average Mass | 129.115 |
| Monoisotopic Mass | 129.04259 |
| SMILES | O=C1C[NH2+]C(C(=O)[O-])C1 |
| InChI | InChI=1S/C5H7NO3/c7-3-1-4(5(8)9)6-2-3/h4,6H,1-2H2,(H,8,9) |
| InChIKey | HFXAFXVXPMUQCQ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxoproline zwitterion (CHEBI:77656) is a amino-acid zwitterion (CHEBI:35238) |
| 4-oxoproline zwitterion (CHEBI:77656) is tautomer of 4-oxoproline (CHEBI:37011) |
| Incoming Relation(s) |
| 4-oxoproline (CHEBI:37011) is tautomer of 4-oxoproline zwitterion (CHEBI:77656) |
| IUPAC Name |
|---|
| 4-oxopyrrolidinium-2-carboxylate |