EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N3O5 |
| Net Charge | 0 |
| Average Mass | 417.506 |
| Monoisotopic Mass | 417.22637 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@H]1CCCN2CCC[C@@H](C(=O)O)N2C1=O |
| InChI | InChI=1S/C22H31N3O5/c1-2-30-22(29)18(13-12-16-8-4-3-5-9-16)23-17-10-6-14-24-15-7-11-19(21(27)28)25(24)20(17)26/h3-5,8-9,17-19,23H,2,6-7,10-15H2,1H3,(H,27,28)/t17-,18-,19-/m0/s1 |
| InChIKey | HHHKFGXWKKUNCY-FHWLQOOXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilazapril (CHEBI:3698) has functional parent Cilazaprilat (CHEBI:81005) |
| cilazapril (CHEBI:3698) has role antihypertensive agent (CHEBI:35674) |
| cilazapril (CHEBI:3698) has role cardiovascular drug (CHEBI:35554) |
| cilazapril (CHEBI:3698) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| cilazapril (CHEBI:3698) has role prodrug (CHEBI:50266) |
| cilazapril (CHEBI:3698) is a dicarboxylic acid monoester (CHEBI:36244) |
| cilazapril (CHEBI:3698) is a ethyl ester (CHEBI:23990) |
| cilazapril (CHEBI:3698) is a pyridazinodiazepine (CHEBI:48393) |
| Incoming Relation(s) |
| cilazapril monohydrate (CHEBI:145568) has part cilazapril (CHEBI:3698) |
| IUPAC Name |
|---|
| (1S,9S)-9-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid |
| INNs | Source |
|---|---|
| cilazapril | WHO MedNet |
| cilazapril | WHO MedNet |
| cilazapril | WHO MedNet |
| cilazaprilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Anhydrous cilazapril | ChEMBL |
| Cilazapril anhydrous | ChemIDplus |
| Cilazapril monohydrate | ChEMBL |
| Initiss | ChEMBL |
| RO 31-2848/006 | ChEMBL |
| RO-312848006 | ChEMBL |
| Brand Names | Source |
|---|---|
| Dynorm | ChEBI |
| Inhibace | KEGG DRUG |
| Vascace | DrugCentral |
| Vascase | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 641 | DrugCentral |
| Cilazapril | Wikipedia |
| D07699 | KEGG DRUG |
| DB01340 | DrugBank |
| HMDB0015433 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:88768-40-5 | ChemIDplus |
| Citations |
|---|