EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N3O5 |
| Net Charge | 0 |
| Average Mass | 417.506 |
| Monoisotopic Mass | 417.22637 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@H]1CCCN2CCC[C@@H](C(=O)O)N2C1=O |
| InChI | InChI=1S/C22H31N3O5/c1-2-30-22(29)18(13-12-16-8-4-3-5-9-16)23-17-10-6-14-24-15-7-11-19(21(27)28)25(24)20(17)26/h3-5,8-9,17-19,23H,2,6-7,10-15H2,1H3,(H,27,28)/t17-,18-,19-/m0/s1 |
| InChIKey | HHHKFGXWKKUNCY-FHWLQOOXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilazapril (CHEBI:3698) has functional parent Cilazaprilat (CHEBI:81005) |
| cilazapril (CHEBI:3698) has role antihypertensive agent (CHEBI:35674) |
| cilazapril (CHEBI:3698) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| cilazapril (CHEBI:3698) has role prodrug (CHEBI:50266) |
| cilazapril (CHEBI:3698) is a dicarboxylic acid monoester (CHEBI:36244) |
| cilazapril (CHEBI:3698) is a ethyl ester (CHEBI:23990) |
| cilazapril (CHEBI:3698) is a pyridazinodiazepine (CHEBI:48393) |
| Incoming Relation(s) |
| cilazapril monohydrate (CHEBI:145568) has part cilazapril (CHEBI:3698) |
| IUPAC Name |
|---|
| (1S,9S)-9-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid |
| INNs | Source |
|---|---|
| cilazapril | WHO MedNet |
| cilazapril | WHO MedNet |
| cilazapril | WHO MedNet |
| cilazaprilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ro 34-2848 | ChemIDplus |
| Cilazapril anhydrous | ChemIDplus |
| Brand Names | Source |
|---|---|
| Vascace | DrugCentral |
| Inhibace | KEGG DRUG |
| Dynorm | ChEBI |
| Vascase | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D07699 | KEGG DRUG |
| 641 | DrugCentral |
| HMDB0015433 | HMDB |
| DB01340 | DrugBank |
| Cilazapril | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:88768-40-5 | ChemIDplus |
| Citations |
|---|