EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N3O5 |
| Net Charge | 0 |
| Average Mass | 389.452 |
| Monoisotopic Mass | 389.19507 |
| SMILES | O=C(O)[C@H](CCc1ccccc1)N[C@H]1CCCN2CCC[C@@H](C(=O)O)N2C1=O |
| InChI | InChI=1S/C20H27N3O5/c24-18-15(8-4-12-22-13-5-9-17(20(27)28)23(18)22)21-16(19(25)26)11-10-14-6-2-1-3-7-14/h1-3,6-7,15-17,21H,4-5,8-13H2,(H,25,26)(H,27,28)/t15-,16-,17-/m0/s1 |
| InChIKey | UVAUYSRYXACKSC-ULQDDVLXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cilazaprilat (CHEBI:81005) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| cilazapril (CHEBI:3698) has functional parent Cilazaprilat (CHEBI:81005) |
| Synonym | Source |
|---|---|
| (1S,9S)-9-((S)-1-Carboxy-3-phenylpropylamino)-10-oxo-4,6,7,8,9,10-hexahydro-1H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17309 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:90139-06-3 | KEGG COMPOUND |