EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N3O5.H2O |
| Net Charge | 0 |
| Average Mass | 435.521 |
| Monoisotopic Mass | 435.23694 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@H]1CCCN2CCC[C@@H](C(=O)O)N2C1=O.O |
| InChI | InChI=1S/C22H31N3O5.H2O/c1-2-30-22(29)18(13-12-16-8-4-3-5-9-16)23-17-10-6-14-24-15-7-11-19(21(27)28)25(24)20(17)26;/h3-5,8-9,17-19,23H,2,6-7,10-15H2,1H3,(H,27,28);1H2/t17-,18-,19-;/m0./s1 |
| InChIKey | JQRZBPFGBRIWSN-YOTVLOEGSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilazapril monohydrate (CHEBI:145568) has part cilazapril (CHEBI:3698) |
| cilazapril monohydrate (CHEBI:145568) has role antihypertensive agent (CHEBI:35674) |
| cilazapril monohydrate (CHEBI:145568) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| cilazapril monohydrate (CHEBI:145568) has role prodrug (CHEBI:50266) |
| cilazapril monohydrate (CHEBI:145568) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| (1S,9S)-9-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid—water (1/1) |
| Synonyms | Source |
|---|---|
| (1S,9S)-9-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid hydrate | IUPAC |
| cilazapril | ChemIDplus |
| cilazapril.H2O | ChEBI |
| cilazapril hydrate | KEGG DRUG |
| Ro 31-2848 monohydrate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Inhibace | KEGG DRUG |
| Justor | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01069 | KEGG DRUG |
| DBSALT001097 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:92077-78-6 | ChemIDplus |
| Citations |
|---|