EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O4 |
| Net Charge | 0 |
| Average Mass | 240.214 |
| Monoisotopic Mass | 240.04226 |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C14H8O4/c15-9-5-1-3-7-11(9)14(18)12-8(13(7)17)4-2-6-10(12)16/h1-6,15-16H |
| InChIKey | QBPFLULOKWLNNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysazin (CHEBI:3682) has role apoptosis inducer (CHEBI:68495) |
| chrysazin (CHEBI:3682) has role plant metabolite (CHEBI:76924) |
| chrysazin (CHEBI:3682) is a dihydroxyanthraquinone (CHEBI:37484) |
| Incoming Relation(s) |
| Aloe emodin (CHEBI:2607) has functional parent chrysazin (CHEBI:3682) |
| chrysophanol (CHEBI:3687) has functional parent chrysazin (CHEBI:3682) |
| IUPAC Name |
|---|
| 1,8-dihydroxyanthracene-9,10-dione |
| INNs | Source |
|---|---|
| dantrona | ChemIDplus |
| dantrone | ChemIDplus |
| dantronum | ChemIDplus |
| dantron | ChEBI |
| Synonyms | Source |
|---|---|
| Chrysazin | KEGG COMPOUND |
| Danthron | KEGG COMPOUND |
| 1,8-Dihydroxyanthraquinone | KEGG COMPOUND |
| 1,8-dihydroxy-9,10-anthraquinone | IUPAC |
| 1,8-dihydroxy-9,10-anthracenedione | NIST Chemistry WebBook |
| 1,8-dihydroxyanthra-9,10-quinone | NIST Chemistry WebBook |
| Citations |
|---|