EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C15H10O4/c1-7-5-9-13(11(17)6-7)15(19)12-8(14(9)18)3-2-4-10(12)16/h2-6,16-17H,1H3 |
| InChIKey | LQGUBLBATBMXHT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aloe vera (ncbitaxon:34199) | - | PubMed (24358188) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysophanol (CHEBI:3687) has functional parent chrysazin (CHEBI:3682) |
| chrysophanol (CHEBI:3687) has role anti-inflammatory agent (CHEBI:67079) |
| chrysophanol (CHEBI:3687) has role antiviral agent (CHEBI:22587) |
| chrysophanol (CHEBI:3687) has role plant metabolite (CHEBI:76924) |
| chrysophanol (CHEBI:3687) is a dihydroxyanthraquinone (CHEBI:37484) |
| Incoming Relation(s) |
| 2-hydroxychrysophanol (CHEBI:7635) has functional parent chrysophanol (CHEBI:3687) |
| chrysophanol 8-O-β-D-glucoside (CHEBI:3688) has functional parent chrysophanol (CHEBI:3687) |
| IUPAC Name |
|---|
| 1,8-dihydroxy-3-methyl-9,10-anthraquinone |
| Synonyms | Source |
|---|---|
| Chrysophanol | KEGG COMPOUND |
| Chrysophanic acid | KEGG COMPOUND |
| 1,8-Dihydroxy-3-methylanthraquinone | KEGG COMPOUND |
| 1,8-dihydroxy-3-methyl-9,10-anthracenedione | ChemIDplus |
| Chrysophansäure | ChEBI |
| 3-methylchrysazin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| chrysophanol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C10315 | KEGG COMPOUND |
| LMPK13040006 | LIPID MAPS |
| CPD-8216 | MetaCyc |
| HMDB0030670 | HMDB |
| Chrysophanol | Wikipedia |
| C00000568 | KNApSAcK |
| LSM-19027 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Gmelin:220618 | Gmelin |
| Reaxys:1252300 | Reaxys |
| CAS:481-74-3 | KEGG COMPOUND |
| CAS:481-74-3 | ChemIDplus |
| Citations |
|---|