EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O5 |
| Net Charge | 0 |
| Average Mass | 270.240 |
| Monoisotopic Mass | 270.05282 |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cc(CO)cc21 |
| InChI | InChI=1S/C15H10O5/c16-6-7-4-9-13(11(18)5-7)15(20)12-8(14(9)19)2-1-3-10(12)17/h1-5,16-18H,6H2 |
| InChIKey | YDQWDHRMZQUTBA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aloe emodin (CHEBI:2607) has functional parent chrysazin (CHEBI:3682) |
| Aloe emodin (CHEBI:2607) has role antineoplastic agent (CHEBI:35610) |
| Aloe emodin (CHEBI:2607) has role plant metabolite (CHEBI:76924) |
| Aloe emodin (CHEBI:2607) is a aromatic primary alcohol (CHEBI:33857) |
| Aloe emodin (CHEBI:2607) is a dihydroxyanthraquinone (CHEBI:37484) |
| IUPAC Name |
|---|
| 1,8-dihydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,8-Dihydroxy-3-hydroxymethylanthraquinone | ChemIDplus |
| 3-(Hydroxymethyl)chrysazin | HMDB |
| Aloe-emodin | KEGG COMPOUND |
| Aloeemodin | HMDB |
| Rhabarberone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| Aloe_emodin | Wikipedia |
| C00002789 | KNApSAcK |
| C10294 | KEGG COMPOUND |
| HMDB0030829 | HMDB |
| LMPK13040002 | LIPID MAPS |
| US4670265 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2059062 | Reaxys |
| CAS:481-72-1 | KEGG COMPOUND |
| CAS:481-72-1 | ChemIDplus |
| Citations |
|---|