EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H4O3 |
| Net Charge | 0 |
| Average Mass | 148.117 |
| Monoisotopic Mass | 148.01604 |
| SMILES | O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H |
| InChIKey | LGRFSURHDFAFJT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phthalic anhydride (CHEBI:36605) has role allergen (CHEBI:50904) |
| phthalic anhydride (CHEBI:36605) is a 2-benzofurans (CHEBI:38831) |
| phthalic anhydride (CHEBI:36605) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| Incoming Relation(s) |
| tetrachlorophthalic anhydride (CHEBI:59097) has functional parent phthalic anhydride (CHEBI:36605) |
| trimellitic anhydride (CHEBI:53050) has functional parent phthalic anhydride (CHEBI:36605) |
| IUPAC Name |
|---|
| 2-benzofuran-1,3-dione |
| Synonyms | Source |
|---|---|
| 1,2-benzenedicarboxylic acid anhydride | NIST Chemistry WebBook |
| 1,3-dioxophthalan | NIST Chemistry WebBook |
| 1,3-isobenzofurandione | NIST Chemistry WebBook |
| 1,3-phthalandione | ChemIDplus |
| o-phthalic acid anhydride | NIST Chemistry WebBook |
| ortho-phthalic acid anhydride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Phthalic_anhydride | Wikipedia |
| Citations |
|---|