EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59097 - tetrachlorophthalic anhydride
| Formula | C8Cl4O3 |
| Net Charge | 0 |
| Average Mass | 285.897 |
| Monoisotopic Mass | 283.86015 |
| SMILES | O=C1OC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
| InChI | InChI=1S/C8Cl4O3/c9-3-1-2(8(14)15-7(1)13)4(10)6(12)5(3)11 |
| InChIKey | AUHHYELHRWCWEZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrachlorophthalic anhydride (CHEBI:59097) has functional parent phthalic anhydride (CHEBI:36605) |
| tetrachlorophthalic anhydride (CHEBI:59097) has role allergen (CHEBI:50904) |
| tetrachlorophthalic anhydride (CHEBI:59097) has role cross-linking reagent (CHEBI:50684) |
| tetrachlorophthalic anhydride (CHEBI:59097) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| tetrachlorophthalic anhydride (CHEBI:59097) is a tetrachlorobenzene (CHEBI:26888) |
| IUPAC Name |
|---|
| 4,5,6,7-tetrachloro-2-benzofuran-1,3-dione |
| Synonyms | Source |
|---|---|
| 1,3-Dioxy-4,5,6,7-tetrachloroisobenzofuran | ChemIDplus |
| 4,5,6,7-Tetrachloro-1,3-isobenzofurandione | ChemIDplus |
| Tetrathal | ChemIDplus |
| etrachlorophthalic acid anhydride | NIST Chemistry WebBook |
| Citations |
|---|