EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H4O5 |
| Net Charge | 0 |
| Average Mass | 192.126 |
| Monoisotopic Mass | 192.00587 |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C9H4O5/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-3H,(H,10,11) |
| InChIKey | SRPWOOOHEPICQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimellitic anhydride (CHEBI:53050) has functional parent phthalic anhydride (CHEBI:36605) |
| trimellitic anhydride (CHEBI:53050) has functional parent trimellitic acid (CHEBI:166055) |
| trimellitic anhydride (CHEBI:53050) has role allergen (CHEBI:50904) |
| trimellitic anhydride (CHEBI:53050) has role epitope (CHEBI:53000) |
| trimellitic anhydride (CHEBI:53050) has role hapten (CHEBI:59174) |
| trimellitic anhydride (CHEBI:53050) is a 2-benzofurans (CHEBI:38831) |
| trimellitic anhydride (CHEBI:53050) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| trimellitic anhydride (CHEBI:53050) is a dioxo monocarboxylic acid (CHEBI:35951) |
| IUPAC Name |
|---|
| 1,3-dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1,2,4-Benzenetricarboxylic acid 1,2-anhydride | ChemIDplus |
| 1,2,4-Benzenetricarboxylic acid anhydride | ChemIDplus |
| 1,2,4-Benzenetricarboxylic acid, cyclic 1,2-anhydride | ChemIDplus |
| 1,3-Dihydro-1,3-dioxo-5-isobenzofurancarboxylic acid | ChemIDplus |
| 1,3-Dioxo-5-phthalancarboxylic acid | ChemIDplus |
| 4-Carboxyphthalic anhydride | NIST Chemistry WebBook |
| Citations |
|---|