EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H4O5 |
| Net Charge | 0 |
| Average Mass | 192.126 |
| Monoisotopic Mass | 192.00587 |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C9H4O5/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-3H,(H,10,11) |
| InChIKey | SRPWOOOHEPICQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimellitic anhydride (CHEBI:53050) has functional parent phthalic anhydride (CHEBI:36605) |
| trimellitic anhydride (CHEBI:53050) has functional parent trimellitic acid (CHEBI:166055) |
| trimellitic anhydride (CHEBI:53050) has role allergen (CHEBI:50904) |
| trimellitic anhydride (CHEBI:53050) has role epitope (CHEBI:53000) |
| trimellitic anhydride (CHEBI:53050) has role hapten (CHEBI:59174) |
| trimellitic anhydride (CHEBI:53050) is a 2-benzofurans (CHEBI:38831) |
| trimellitic anhydride (CHEBI:53050) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| trimellitic anhydride (CHEBI:53050) is a dioxo monocarboxylic acid (CHEBI:35951) |
| IUPAC Name |
|---|
| 1,3-dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1,2,4-Benzenetricarboxylic acid 1,2-anhydride | ChemIDplus |
| 1,2,4-Benzenetricarboxylic acid anhydride | ChemIDplus |
| 1,2,4-Benzenetricarboxylic acid, cyclic 1,2-anhydride | ChemIDplus |
| 1,3-Dihydro-1,3-dioxo-5-isobenzofurancarboxylic acid | ChemIDplus |
| 1,3-Dioxo-5-phthalancarboxylic acid | ChemIDplus |
| 4-Carboxyphthalic anhydride | NIST Chemistry WebBook |
| Citations |
|---|