EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClNS |
| Net Charge | 0 |
| Average Mass | 315.869 |
| Monoisotopic Mass | 315.08485 |
| SMILES | [H]C(CCN(C)C)=C1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClNS/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18/h3-4,6-10,12H,5,11H2,1-2H3 |
| InChIKey | WSPOMRSOLSGNFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorprothixene (CHEBI:3651) has role antiemetic (CHEBI:50919) |
| chlorprothixene (CHEBI:3651) has role cholinergic antagonist (CHEBI:48873) |
| chlorprothixene (CHEBI:3651) has role dopaminergic antagonist (CHEBI:48561) |
| chlorprothixene (CHEBI:3651) has role first generation antipsychotic (CHEBI:65190) |
| chlorprothixene (CHEBI:3651) has role non-narcotic analgesic (CHEBI:35481) |
| chlorprothixene (CHEBI:3651) has role sedative (CHEBI:35717) |
| chlorprothixene (CHEBI:3651) is a organochlorine compound (CHEBI:36683) |
| chlorprothixene (CHEBI:3651) is a tertiary amino compound (CHEBI:50996) |
| chlorprothixene (CHEBI:3651) is a thioxanthenes (CHEBI:50930) |
| chlorprothixene (CHEBI:3651) is conjugate base of chlorprothixene(1+) (CHEBI:180503) |
| Incoming Relation(s) |
| (E)-chlorprothixene (CHEBI:50932) is a chlorprothixene (CHEBI:3651) |
| (Z)-chlorprothixene (CHEBI:50931) is a chlorprothixene (CHEBI:3651) |
| chlorprothixene(1+) (CHEBI:180503) is conjugate acid of chlorprothixene (CHEBI:3651) |
| IUPAC Name |
|---|
| 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine |
| INNs | Source |
|---|---|
| chlorprothixene | ChEBI |
| chlorprothixène | ChEBI |
| chlorprothixenum | ChEBI |
| clorprotixeno | ChEBI |
| Synonyms | Source |
|---|---|
| Alpha-Chlorprothixene | DrugBank |
| Chlorprothixen | DrugBank |
| Chlorprothixene | KEGG COMPOUND |
| Chlorprothixine | DrugBank |
| Chlorprotixen | DrugBank |
| Chlorprotixene | DrugBank |