EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19ClNS |
| Net Charge | +1 |
| Average Mass | 316.877 |
| Monoisotopic Mass | 316.09212 |
| SMILES | [H]C(CC[NH+](C)C)=C1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClNS/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18/h3-4,6-10,12H,5,11H2,1-2H3/p+1 |
| InChIKey | WSPOMRSOLSGNFJ-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorprothixene(1+) (CHEBI:180503) is a tertiary ammonium ion (CHEBI:137982) |
| chlorprothixene(1+) (CHEBI:180503) is conjugate acid of chlorprothixene (CHEBI:3651) |
| Incoming Relation(s) |
| chlorprothixene hydrochloride (CHEBI:180502) has part chlorprothixene(1+) (CHEBI:180503) |
| chlorprothixene (CHEBI:3651) is conjugate base of chlorprothixene(1+) (CHEBI:180503) |
| IUPAC Name |
|---|
| 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethylpropan-1-aminium |
| Synonym | Source |
|---|---|
| chlorprothixene cation | ChEBI |