EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClNS |
| Net Charge | 0 |
| Average Mass | 315.869 |
| Monoisotopic Mass | 315.08485 |
| SMILES | [H]/C(CCN(C)C)=C1\c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClNS/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18/h3-4,6-10,12H,5,11H2,1-2H3/b14-7- |
| InChIKey | WSPOMRSOLSGNFJ-AUWJEWJLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-chlorprothixene (CHEBI:50931) is a chlorprothixene (CHEBI:3651) |
| IUPAC Name |
|---|
| (3Z)-3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine |
| INNs | Source |
|---|---|
| Chlorprothixenum | ChEBI |
| Clorprotixeno | ChEBI |
| Synonyms | Source |
|---|---|
| (3Z)-3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine | ChEBI |
| Chlorprothixene | ChemIDplus |
| cis-2-Chloro-9-(3-dimethylaminopropylidene)thioxanthene | ChemIDplus |
| cis-chlorprothixene | ChEBI |
| (Z)-2-Chloro-9-(omega-dimethylaminopropylidene)thioxanthene | ChemIDplus |
| Citations |
|---|