EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O9 |
| Net Charge | 0 |
| Average Mass | 478.538 |
| Monoisotopic Mass | 478.22028 |
| SMILES | [H][C@@]12CCc3cc(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)c(OC)cc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H34O9/c1-25-8-7-12-13(15(25)5-6-18(25)26)4-3-11-9-17(16(32-2)10-14(11)12)33-24-21(29)19(27)20(28)22(34-24)23(30)31/h9-10,12-13,15,18-22,24,26-29H,3-8H2,1-2H3,(H,30,31)/t12-,13+,15-,18-,19-,20-,21+,22-,24+,25-/m0/s1 |
| InChIKey | LLCPFVIBUZJITJ-GVEMAFOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) has functional parent 2-methoxy-17β-estradiol (CHEBI:28955) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) has role mouse metabolite (CHEBI:75771) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) is a 17β-hydroxy steroid (CHEBI:35343) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) is a aromatic ether (CHEBI:35618) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) is a steroid glucosiduronic acid (CHEBI:26763) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) is a β-D-glucosiduronic acid (CHEBI:15341) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) is conjugate acid of 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide)(1−) (CHEBI:136974) |
| Incoming Relation(s) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide)(1−) (CHEBI:136974) is conjugate base of 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) |
| IUPAC Name |
|---|
| 17β-hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| (17β)-17-hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronic acid | ChEBI |
| 2-MeOE2 3G | ChEBI |
| 2-methoxy-17β-estradiol 3-O-glucuronide | ChEBI |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronic acid) | ChEBI |
| 2-methoxy-17β-estradiol 3-glucosiduronic acid | ChEBI |
| 2-methoxy-17β-estradiol 3-glucuronide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11131 | KEGG COMPOUND |
| HMDB0006765 | HMDB |
| LMST05010009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20544762 | Reaxys |
| Citations |
|---|