EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33O9 |
| Net Charge | -1 |
| Average Mass | 477.530 |
| Monoisotopic Mass | 477.21301 |
| SMILES | [H][C@@]12CCc3cc(O[C@@H]4O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]4O)c(OC)cc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H34O9/c1-25-8-7-12-13(15(25)5-6-18(25)26)4-3-11-9-17(16(32-2)10-14(11)12)33-24-21(29)19(27)20(28)22(34-24)23(30)31/h9-10,12-13,15,18-22,24,26-29H,3-8H2,1-2H3,(H,30,31)/p-1/t12-,13+,15-,18-,19-,20-,21+,22-,24+,25-/m0/s1 |
| InChIKey | LLCPFVIBUZJITJ-GVEMAFOVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide)(1−) (CHEBI:136974) is a monocarboxylic acid anion (CHEBI:35757) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide)(1−) (CHEBI:136974) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide)(1−) (CHEBI:136974) is a β-D-glucosiduronate (CHEBI:83411) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide)(1−) (CHEBI:136974) is conjugate base of 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) |
| Incoming Relation(s) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) is conjugate acid of 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide)(1−) (CHEBI:136974) |
| IUPAC Name |
|---|
| 17β-hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronate |
| Synonyms | Source |
|---|---|
| (17β)-17-hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronate | IUPAC |
| 2-MeOE2 3G(1−) | SUBMITTER |
| 2-methoxy-17β-estradiol 3-O-glucuronide(1−) | ChEBI |
| 2-methoxy-17β-estradiol 3-glucosiduronate | ChEBI |
| 2-methoxy-17β-estradiol 3-glucuronide(1−) | ChEBI |
| 2-methoxy-17β-estradiol 3-β-glucuronide(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronate) | UniProt |
| Citations |
|---|