EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@@]12CCc3cc(O)c(OC)cc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H26O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(22-2)10-14(11)12/h9-10,12-13,15,18,20-21H,3-8H2,1-2H3/t12-,13+,15-,18-,19-/m0/s1 |
| InChIKey | CQOQDQWUFQDJMK-SSTWWWIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-17β-estradiol (CHEBI:28955) has functional parent 17β-estradiol (CHEBI:16469) |
| 2-methoxy-17β-estradiol (CHEBI:28955) has role angiogenesis modulating agent (CHEBI:50926) |
| 2-methoxy-17β-estradiol (CHEBI:28955) has role antimitotic (CHEBI:64911) |
| 2-methoxy-17β-estradiol (CHEBI:28955) has role antineoplastic agent (CHEBI:35610) |
| 2-methoxy-17β-estradiol (CHEBI:28955) has role human metabolite (CHEBI:77746) |
| 2-methoxy-17β-estradiol (CHEBI:28955) has role metabolite (CHEBI:25212) |
| 2-methoxy-17β-estradiol (CHEBI:28955) has role mouse metabolite (CHEBI:75771) |
| 2-methoxy-17β-estradiol (CHEBI:28955) is a 17β-hydroxy steroid (CHEBI:35343) |
| 2-methoxy-17β-estradiol (CHEBI:28955) is a 3-hydroxy steroid (CHEBI:36834) |
| Incoming Relation(s) |
| 2-methoxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:36491) has functional parent 2-methoxy-17β-estradiol (CHEBI:28955) |
| IUPAC Name |
|---|
| 2-methoxyestra-1,3,5(10)-triene-3,17β-diol |
| Synonyms | Source |
|---|---|
| 1,3,5(10)-ESTRATRIEN-2,3,17-BETA-TRIOL 2-METHYL ETHER | PDBeChem |
| 2-Hydroxyestradol 2-methyl ether | ChemIDplus |
| 2-methoxyestradiol | ChEBI |
| 2-Methoxyestradiol-17beta | KEGG COMPOUND |
| Panzem | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-methoxy-17β-estradiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05302 | KEGG COMPOUND |
| CA2499254 | Patent |
| CN1672746 | Patent |
| JP2005270658 | Patent |
| LMST02010035 | LIPID MAPS |
| US2009104246 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3147966 | Reaxys |
| CAS:362-07-2 | ChemIDplus |
| CAS:362-07-2 | KEGG COMPOUND |
| Citations |
|---|