EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11ClO3 |
| Net Charge | 0 |
| Average Mass | 202.637 |
| Monoisotopic Mass | 202.03967 |
| SMILES | OCC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H11ClO3/c10-7-1-3-9(4-2-7)13-6-8(12)5-11/h1-4,8,11-12H,5-6H2 |
| InChIKey | MXOAEAUPQDYUQM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antibacterial drug A drug used to treat or prevent bacterial infections. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorphenesin (CHEBI:3642) has role antibacterial drug (CHEBI:36047) |
| chlorphenesin (CHEBI:3642) has role antifungal drug (CHEBI:86327) |
| chlorphenesin (CHEBI:3642) has role muscle relaxant (CHEBI:51371) |
| chlorphenesin (CHEBI:3642) is a glycol (CHEBI:13643) |
| chlorphenesin (CHEBI:3642) is a monochlorobenzenes (CHEBI:83403) |
| chlorphenesin (CHEBI:3642) is a propane-1,2-diols (CHEBI:26284) |
| Incoming Relation(s) |
| chlorphenesin carbamate (CHEBI:3643) has functional parent chlorphenesin (CHEBI:3642) |
| (R)-chlorphenesin (CHEBI:59479) is a chlorphenesin (CHEBI:3642) |
| (S)-chlorphenesin (CHEBI:59480) is a chlorphenesin (CHEBI:3642) |
| IUPAC Name |
|---|
| 3-(4-chlorophenoxy)propane-1,2-diol |
| INNs | Source |
|---|---|
| chlorphénésine | WHO MedNet |
| chlorphenesinum | ChemIDplus |
| chlorphenesin | ChemIDplus |
| clorfenesina | ChemIDplus |
| Synonyms | Source |
|---|---|
| Chlorphenesin | KEGG COMPOUND |
| chlorphenesin | ChEMBL |
| 3-(p-chlorophenoxy)-1,2-propanediol | ChemIDplus |
| p-chlorophenyl-α-glyceryl ether | NIST Chemistry WebBook |
| 3-(4-chlorophenoxy)-1,2-propanediol | ChEBI |
| glycerol α-p-chlorophenyl ether | ChemIDplus |
| Citations |
|---|