EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19ClN2O2.HCl |
| Net Charge | 0 |
| Average Mass | 307.221 |
| Monoisotopic Mass | 306.09018 |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1Cl.Cl |
| InChI | InChI=1S/C13H19ClN2O2.ClH/c1-3-16(4-2)7-8-18-13(17)11-6-5-10(15)9-12(11)14;/h5-6,9H,3-4,7-8,15H2,1-2H3;1H |
| InChIKey | SZKQYDBPUCZLRX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloroprocaine hydrochloride (CHEBI:3637) has part chloroprocaine (CHEBI:3636) |
| chloroprocaine hydrochloride (CHEBI:3637) has role central nervous system depressant (CHEBI:35488) |
| chloroprocaine hydrochloride (CHEBI:3637) has role local anaesthetic (CHEBI:36333) |
| chloroprocaine hydrochloride (CHEBI:3637) has role peripheral nervous system drug (CHEBI:49110) |
| chloroprocaine hydrochloride (CHEBI:3637) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-(diethylamino)ethyl 4-amino-2-chlorobenzoate hydrochloride |
| Synonyms | Source |
|---|---|
| [2-(4-Amino-2-chloro-benzoyloxy)-ethyl]-diethyl-ammonium; chloride | ChEMBL |
| 2-(diethylamino)ethyl 4-amino-2-chlorobenzoate monohydrochloride | ChemIDplus |
| 4-amino-2-chlorobenzoic acid 2-(diethylamino)ethyl ester hydrochloride | ChemIDplus |
| chloroprocaine HCl | ChemIDplus |
| Citations |
|---|