EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2 |
| Net Charge | 0 |
| Average Mass | 278.399 |
| Monoisotopic Mass | 278.17830 |
| SMILES | [H]/C(C)=C1\CN2[C@@]3([H])C[C@]1([H])[C@@]([H])(C)[C@]2([H])Cc1c3nc2ccccc12 |
| InChI | InChI=1S/C19H22N2/c1-3-12-10-21-17-9-15-13-6-4-5-7-16(13)20-19(15)18(21)8-14(12)11(17)2/h3-7,11,14,17-18,20H,8-10H2,1-2H3/b12-3-/t11-,14-,17+,18+/m1/s1 |
| InChIKey | IYHCUPNFCQEQJQ-NDFCTVCRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sarpagan (CHEBI:36312) is a indole alkaloid (CHEBI:38958) |
| sarpagan (CHEBI:36312) is a indole alkaloid fundamental parent (CHEBI:38482) |
| Incoming Relation(s) |
| 10-deoxysarpagine (CHEBI:16060) has functional parent sarpagan (CHEBI:36312) |
| 16-epivellosimine (CHEBI:16425) has parent hydride sarpagan (CHEBI:36312) |
| sarpagine (CHEBI:9036) has parent hydride sarpagan (CHEBI:36312) |
| vellosimine (CHEBI:18057) has parent hydride sarpagan (CHEBI:36312) |
| IUPAC Name |
|---|
| sarpagan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:759382 | Beilstein |