EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O2 |
| Net Charge | 0 |
| Average Mass | 310.397 |
| Monoisotopic Mass | 310.16813 |
| SMILES | [H]/C(C)=C1\CN2[C@@]3([H])C[C@]1([H])[C@@]([H])(CO)[C@]2([H])Cc1c3nc2ccc(O)cc12 |
| InChI | InChI=1S/C19H22N2O2/c1-2-10-8-21-17-7-14-13-5-11(23)3-4-16(13)20-19(14)18(21)6-12(10)15(17)9-22/h2-5,12,15,17-18,20,22-23H,6-9H2,1H3/b10-2-/t12-,15+,17-,18-/m0/s1 |
| InChIKey | VTVQHYQGTTVKDE-CCUKBNNFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sarpagine (CHEBI:9036) has parent hydride sarpagan (CHEBI:36312) |
| sarpagine (CHEBI:9036) is a indole alkaloid (CHEBI:38958) |
| sarpagine (CHEBI:9036) is a phenols (CHEBI:33853) |
| sarpagine (CHEBI:9036) is a primary alcohol (CHEBI:15734) |
| sarpagine (CHEBI:9036) is a secondary amino compound (CHEBI:50995) |
| sarpagine (CHEBI:9036) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| polyneuridine aldehyde (CHEBI:16829) has functional parent sarpagine (CHEBI:9036) |
| IUPAC Name |
|---|
| sarpagan-10,17-diol |
| Synonyms | Source |
|---|---|
| 10,17-sarpagandiol | ChemIDplus |
| raupin | ChemIDplus |
| (+)-sarpagine | ChEBI |
| Sarpagine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| sarpagine | UniProt |
| Citations |
|---|