EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O |
| Net Charge | 0 |
| Average Mass | 294.398 |
| Monoisotopic Mass | 294.17321 |
| SMILES | [H]/C(C)=C1\CN2[C@@]3([H])C[C@]1([H])[C@@]([H])(CO)[C@]2([H])Cc1c3nc2ccccc12 |
| InChI | InChI=1S/C19H22N2O/c1-2-11-9-21-17-8-14-12-5-3-4-6-16(12)20-19(14)18(21)7-13(11)15(17)10-22/h2-6,13,15,17-18,20,22H,7-10H2,1H3/b11-2-/t13-,15+,17-,18-/m0/s1 |
| InChIKey | VXTDUGOBAOLMED-VICVVEARSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-deoxysarpagine (CHEBI:16060) has functional parent sarpagan (CHEBI:36312) |
| 10-deoxysarpagine (CHEBI:16060) is a indole alkaloid (CHEBI:38958) |
| 10-deoxysarpagine (CHEBI:16060) is a primary alcohol (CHEBI:15734) |
| 10-deoxysarpagine (CHEBI:16060) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| sarpagan-17-ol |
| Synonyms | Source |
|---|---|
| 10-Deoxysarpagine | KEGG COMPOUND |
| Sarpagan-17-ol | KEGG COMPOUND |
| normacusine B | ChEBI |
| tombozine | ChEBI |
| vellosiminol | ChEBI |
| tombozin | ChEBI |
| UniProt Name | Source |
|---|---|
| 10-deoxysarpagine | UniProt |
| Citations |
|---|