EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11O4 |
| Net Charge | -1 |
| Average Mass | 159.161 |
| Monoisotopic Mass | 159.06628 |
| SMILES | O=C([O-])CCCCCC(=O)O |
| InChI | InChI=1S/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11)/p-1 |
| InChIKey | WLJVNTCWHIRURA-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimelate(1−) (CHEBI:17774) has role Escherichia coli metabolite (CHEBI:76971) |
| pimelate(1−) (CHEBI:17774) is a dicarboxylic acid monoanion (CHEBI:35695) |
| pimelate(1−) (CHEBI:17774) is a pimelate (CHEBI:133773) |
| pimelate(1−) (CHEBI:17774) is conjugate acid of pimelate(2−) (CHEBI:36165) |
| pimelate(1−) (CHEBI:17774) is conjugate base of pimelic acid (CHEBI:30531) |
| Incoming Relation(s) |
| pimelic acid (CHEBI:30531) is conjugate acid of pimelate(1−) (CHEBI:17774) |
| pimelate(2−) (CHEBI:36165) is conjugate base of pimelate(1−) (CHEBI:17774) |
| IUPAC Name |
|---|
| 6-carboxyhexanoate |
| Synonyms | Source |
|---|---|
| heptanedioate | ChEBI |
| hydrogen pimelate | ChEBI |
| Pimelate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1449709 | Gmelin |