EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O5 |
| Net Charge | -2 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02262 |
| SMILES | O=C([O-])CCC(O)C(=O)[O-] |
| InChI | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/p-2 |
| InChIKey | HWXBTNAVRSUOJR-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyglutarate(2−) (CHEBI:11596) has functional parent glutarate(2−) (CHEBI:30921) |
| 2-hydroxyglutarate(2−) (CHEBI:11596) is a 2-hydroxyglutarate (CHEBI:132941) |
| 2-hydroxyglutarate(2−) (CHEBI:11596) is a dicarboxylic acid dianion (CHEBI:28965) |
| 2-hydroxyglutarate(2−) (CHEBI:11596) is conjugate base of 2-hydroxyglutarate(1−) (CHEBI:36149) |
| Incoming Relation(s) |
| (R)-2-hydroxyglutarate(2−) (CHEBI:15801) is a 2-hydroxyglutarate(2−) (CHEBI:11596) |
| (S)-2-hydroxyglutarate(2−) (CHEBI:16782) is a 2-hydroxyglutarate(2−) (CHEBI:11596) |
| 2-hydroxyglutarate(1−) (CHEBI:36149) is conjugate acid of 2-hydroxyglutarate(2−) (CHEBI:11596) |
| IUPAC Name |
|---|
| 2-hydroxypentanedioate |
| UniProt Name | Source |
|---|---|
| 2-hydroxyglutarate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2-HYDROXYGLUTARIC_ACID | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5736650 | Reaxys |