EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30Cl2N10 |
| Net Charge | 0 |
| Average Mass | 505.458 |
| Monoisotopic Mass | 504.20320 |
| SMILES | N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(Cl)cc1)NC(=N)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30Cl2N10/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34) |
| InChIKey | GHXZTYHSJHQHIJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorhexidine (CHEBI:3614) has functional parent biguanide (CHEBI:3095) |
| chlorhexidine (CHEBI:3614) has role antibacterial agent (CHEBI:33282) |
| chlorhexidine (CHEBI:3614) has role antiinfective agent (CHEBI:35441) |
| chlorhexidine (CHEBI:3614) is a biguanides (CHEBI:53662) |
| chlorhexidine (CHEBI:3614) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| chlorhexidine gluconate (CHEBI:28312) has functional parent chlorhexidine (CHEBI:3614) |
| chlorhexidine acetate (CHEBI:81711) has part chlorhexidine (CHEBI:3614) |
| IUPAC Name |
|---|
| N',N'''''-hexane-1,6-diylbis[N-(4-chlorophenyl)(imidodicarbonimidic diamide)] |
| Synonyms | Source |
|---|---|
| 1,1'-Hexamethylene bis(5-(p-chlorophenyl)biguanide) | ChemIDplus |
| Chlorhexidine | KEGG COMPOUND |
| N,N'-Bis(4-chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide | ChemIDplus |
| Citations |
|---|