EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30Cl2N10.2C2H4O2 |
| Net Charge | 0 |
| Average Mass | 625.562 |
| Monoisotopic Mass | 624.24546 |
| SMILES | CC(=O)O.CC(=O)O.N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(Cl)cc1)NC(=N)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30Cl2N10.2C2H4O2/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;2*1-2(3)4/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);2*1H3,(H,3,4) |
| InChIKey | WDRFFJWBUDTUCA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antifouling biocide A compound that inhibits the growth of marine organisms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorhexidine acetate (CHEBI:81711) has part chlorhexidine (CHEBI:3614) |
| chlorhexidine acetate (CHEBI:81711) has role antibacterial agent (CHEBI:33282) |
| chlorhexidine acetate (CHEBI:81711) has role antifouling biocide (CHEBI:51076) |
| chlorhexidine acetate (CHEBI:81711) has role antifungal agent (CHEBI:35718) |
| chlorhexidine acetate (CHEBI:81711) has role antiinfective agent (CHEBI:35441) |
| chlorhexidine acetate (CHEBI:81711) is a acetate salt (CHEBI:59230) |
| IUPAC Name |
|---|
| N,N''''-hexane-1,6-diylbis[N'-(4-chlorophenyl)triimidodicarbonic diamide] acetate (1:2) |
| Synonyms | Source |
|---|---|
| 1,1'-hexamethylene bis(5-(p-chlorophenyl)biguanide) diacetate | ChemIDplus |
| acetic acid--N,N''''-hexane-1,6-diylbis[N'-(4-chlorophenyl)triimidodicarbonic diamide] (2/1) | IUPAC |
| chlorhexidine di(acetate) | ChEBI |
| chlorhexidine diacetate | KEGG COMPOUND |
| chlorhexidine diacetate salt | ChEBI |
| Brand Name | Source |
|---|---|
| Nolvasan | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 7838272 | ChemSpider |
| C18372 | KEGG COMPOUND |
| D07669 | KEGG DRUG |
| DBSALT001123 | DrugBank |
| EP2376129 | Patent |
| WO2012033625 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:56-95-1 | ChemIDplus |
| Citations |
|---|