EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30Cl2N10.2C6H12O7 |
| Net Charge | 0 |
| Average Mass | 897.768 |
| Monoisotopic Mass | 896.31980 |
| SMILES | N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(Cl)cc1)NC(=N)Nc1ccc(Cl)cc1.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C22H30Cl2N10.2C6H12O7/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;2*7-1-2(8)3(9)4(10)5(11)6(12)13/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);2*2-5,7-11H,1H2,(H,12,13)/t;2*2-,3-,4+,5-/m.11/s1 |
| InChIKey | YZIYKJHYYHPJIB-UUPCJSQJSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorhexidine gluconate (CHEBI:28312) has functional parent chlorhexidine (CHEBI:3614) |
| chlorhexidine gluconate (CHEBI:28312) has role anti-HIV agent (CHEBI:64946) |
| chlorhexidine gluconate (CHEBI:28312) has role anti-inflammatory agent (CHEBI:67079) |
| chlorhexidine gluconate (CHEBI:28312) has role antibacterial agent (CHEBI:33282) |
| chlorhexidine gluconate (CHEBI:28312) has role antifungal drug (CHEBI:86327) |
| chlorhexidine gluconate (CHEBI:28312) has role antiinfective agent (CHEBI:35441) |
| chlorhexidine gluconate (CHEBI:28312) has role antimicrobial agent (CHEBI:33281) |
| chlorhexidine gluconate (CHEBI:28312) has role antineoplastic agent (CHEBI:35610) |
| chlorhexidine gluconate (CHEBI:28312) has role antiviral agent (CHEBI:22587) |
| chlorhexidine gluconate (CHEBI:28312) has role dermatologic drug (CHEBI:50177) |
| chlorhexidine gluconate (CHEBI:28312) has role ophthalmology drug (CHEBI:66981) |
| chlorhexidine gluconate (CHEBI:28312) is a D-gluconate adduct (CHEBI:20984) |
| chlorhexidine gluconate (CHEBI:28312) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| N',N'''''-hexane-1,6-diylbis[N-(4-chlorophenyl)(imidodicarbonimidic diamide)]—D-gluconic acid (1/2) |
| Synonyms | Source |
|---|---|
| 1,1'-hexamethylene bis(5-(p-chlorophenyl)biguanide), digluconate | ChemIDplus |
| Chlohexidine gluconate | ChEMBL |
| chlorhexidine digluconate | KEGG DRUG |
| chlorhexidine di-D-gluconate | ChemIDplus |
| chlorhexidine gluconate | KEGG DRUG |
| chlorhexidine D-digluconate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Acriflex | ChEMBL |
| Aerocide 1 | ChEMBL |
| Bacticlens | ChEMBL |
| Bioscrub | ChEMBL |
| Brian care | ChEMBL |
| Cepton | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00858 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4348068 | Beilstein |
| CAS:18472-51-0 | KEGG DRUG |