EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30Cl2N10.2C6H12O7 |
| Net Charge | 0 |
| Average Mass | 897.768 |
| Monoisotopic Mass | 896.31980 |
| SMILES | N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(Cl)cc1)NC(=N)Nc1ccc(Cl)cc1.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C22H30Cl2N10.2C6H12O7/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;2*7-1-2(8)3(9)4(10)5(11)6(12)13/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);2*2-5,7-11H,1H2,(H,12,13)/t;2*2-,3-,4+,5-/m.11/s1 |
| InChIKey | YZIYKJHYYHPJIB-UUPCJSQJSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorhexidine gluconate (CHEBI:28312) has functional parent chlorhexidine (CHEBI:3614) |
| chlorhexidine gluconate (CHEBI:28312) has role antibacterial agent (CHEBI:33282) |
| chlorhexidine gluconate (CHEBI:28312) is a D-gluconate adduct (CHEBI:20984) |
| chlorhexidine gluconate (CHEBI:28312) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| N',N'''''-hexane-1,6-diylbis[N-(4-chlorophenyl)(imidodicarbonimidic diamide)]—D-gluconic acid (1/2) |
| Synonyms | Source |
|---|---|
| 1,1'-hexamethylene bis(5-(p-chlorophenyl)biguanide), digluconate | ChemIDplus |
| chlorhexidine digluconate | KEGG DRUG |
| chlorhexidine di-D-gluconate | ChemIDplus |
| chlorhexidine gluconate | KEGG DRUG |
| chlorhexidine D-digluconate | ChemIDplus |
| Hibiclens | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00858 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4348068 | Beilstein |
| CAS:18472-51-0 | KEGG DRUG |